C32H32O8S2 — CID 53353358
6-(3,4-dimethoxyphenyl)sulfanyl-2-[1-(3,4-dimethoxyphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione (PubChem CID 53353358) has the molecular formula C32H32O8S2 and a molecular weight of 608.73 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)sulfanyl-2-[1-(3,4-dimethoxyphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione.
| Compound Name | 6-(3,4-dimethoxyphenyl)sulfanyl-2-[1-(3,4-dimethoxyphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 53353358 |
| Molecular Formula | C32H32O8S2 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)sulfanyl-2-[1-(3,4-dimethoxyphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione |
| SMILES | COc1ccc(Sc2cc(O)c3c(c2O)C(=O)C=C(C(CC=C(C)C)Sc2ccc(OC)c(OC)c2)C3=O)cc1OC |
| InChI | InChI=1S/C32H32O8S2/c1-17(2)7-12-27(41-18-8-10-23(37-3)25(13-18)39-5)20-15-21(33)30-29(31(20)35)22(34)16-28(32(30)36)42-19-9-11-24(38-4)26(14-19)40-6/h7-11,13-16,27,34,36H,12H2,1-6H3 |
| InChIKey | VPQQAGFYDNJAKI-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|