C26H26O6S — CID 141163844
S-[1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-methoxybenzenecarbothioate (PubChem CID 141163844) has the molecular formula C26H26O6S and a molecular weight of 466.56 g/mol. Its IUPAC name is S-[1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-methoxybenzenecarbothioate.
| Compound Name | S-[1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-methoxybenzenecarbothioate |
|---|---|
| PubChem CID | 141163844 |
| Molecular Formula | C26H26O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | S-[1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 4-methoxybenzenecarbothioate |
| SMILES | COc1ccc(C(=O)SC(CC=C(C)C)C2=CC(=O)c3c(OC)ccc(OC)c3C2=O)cc1 |
| InChI | InChI=1S/C26H26O6S/c1-15(2)6-13-22(33-26(29)16-7-9-17(30-3)10-8-16)18-14-19(27)23-20(31-4)11-12-21(32-5)24(23)25(18)28/h6-12,14,22H,13H2,1-5H3 |
| InChIKey | CYBJERPNVLSPGR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|