C26H18N2O4S2 — CID 163939420
4,8-diamino-1,5-dihydroxy-2,6-bis(phenylsulfanyl)anthracene-9,10-dione (PubChem CID 163939420) has the molecular formula C26H18N2O4S2 and a molecular weight of 486.57 g/mol. Its IUPAC name is 4,8-diamino-1,5-dihydroxy-2,6-bis(phenylsulfanyl)anthracene-9,10-dione.
| Compound Name | 4,8-diamino-1,5-dihydroxy-2,6-bis(phenylsulfanyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 163939420 |
| Molecular Formula | C26H18N2O4S2 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 4,8-diamino-1,5-dihydroxy-2,6-bis(phenylsulfanyl)anthracene-9,10-dione |
| SMILES | Nc1cc(Sc2ccccc2)c(O)c2c1C(=O)c1c(O)c(Sc3ccccc3)cc(N)c1C2=O |
| InChI | InChI=1S/C26H18N2O4S2/c27-15-11-17(33-13-7-3-1-4-8-13)23(29)21-19(15)26(32)22-20(25(21)31)16(28)12-18(24(22)30)34-14-9-5-2-6-10-14/h1-12,29-30H,27-28H2 |
| InChIKey | RPSDRNUDAAHLAM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|