C12H13N3O4S3 — CID 121003354
4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide (PubChem CID 121003354) has the molecular formula C12H13N3O4S3 and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide.
| Compound Name | 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 121003354 |
| Molecular Formula | C12H13N3O4S3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide |
| SMILES | Nc1cc(Sc2ccccc2)c(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H13N3O4S3/c13-9-6-10(20-8-4-2-1-3-5-8)12(22(15,18)19)7-11(9)21(14,16)17/h1-7H,13H2,(H2,14,16,17)(H2,15,18,19) |
| InChIKey | XBJCGFYGHHAPEY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|