About 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide
4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide (PubChem CID 121003354) has the molecular formula C12H13N3O4S3
and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide.
Molecular Properties
| Compound Name | 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide |
| PubChem CID | 121003354 |
| Molecular Formula | C12H13N3O4S3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide |
| SMILES | Nc1cc(Sc2ccccc2)c(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H13N3O4S3/c13-9-6-10(20-8-4-2-1-3-5-8)12(22(15,18)19)7-11(9)21(14,16)17/h1-7H,13H2,(H2,14,16,17)(H2,15,18,19) |
| InChIKey | XBJCGFYGHHAPEY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide?
The IUPAC name of 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide (CID 121003354) is 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide.
What is the SMILES notation for 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide?
The canonical SMILES for 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide is Nc1cc(Sc2ccccc2)c(S(N)(=O)=O)cc1S(N)(=O)=O.
What is the InChIKey of 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide?
The InChIKey is XBJCGFYGHHAPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O4S3/c13-9-6-10(20-8-4-2-1-3-5-8)12(22(15,18)19)7-11(9)21(14,16)17/h1-7H,13H2,(H2,14,16,17)(H2,15,18,19).
What are the key properties of 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide?
4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide has a molecular weight of 359.45 g/mol, XLogP of 0.71, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-phenylsulfanylbenzene-1,3-disulfonamide is sourced from PubChem (CID 121003354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).