C18H14ClNS2 — CID 14765109
4-chloro-2,5-bis(phenylsulfanyl)aniline (PubChem CID 14765109) has the molecular formula C18H14ClNS2 and a molecular weight of 343.90 g/mol. Its IUPAC name is 4-chloro-2,5-bis(phenylsulfanyl)aniline.
| Compound Name | 4-chloro-2,5-bis(phenylsulfanyl)aniline |
|---|---|
| PubChem CID | 14765109 |
| Molecular Formula | C18H14ClNS2 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-chloro-2,5-bis(phenylsulfanyl)aniline |
| SMILES | Nc1cc(Sc2ccccc2)c(Cl)cc1Sc1ccccc1 |
| InChI | InChI=1S/C18H14ClNS2/c19-15-11-18(22-14-9-5-2-6-10-14)16(20)12-17(15)21-13-7-3-1-4-8-13/h1-12H,20H2 |
| InChIKey | INJKNCRILUZSDN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|