C12H14N4S — CID 139667343
5-phenylsulfanylbenzene-1,2,3,4-tetramine (PubChem CID 139667343) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 5-phenylsulfanylbenzene-1,2,3,4-tetramine.
| Compound Name | 5-phenylsulfanylbenzene-1,2,3,4-tetramine |
|---|---|
| PubChem CID | 139667343 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-phenylsulfanylbenzene-1,2,3,4-tetramine |
| SMILES | Nc1cc(Sc2ccccc2)c(N)c(N)c1N |
| InChI | InChI=1S/C12H14N4S/c13-8-6-9(11(15)12(16)10(8)14)17-7-4-2-1-3-5-7/h1-6H,13-16H2 |
| InChIKey | UQLJUSNFCUXKSM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|