C12H9N3O4S — CID 11066228
2,4-dinitro-6-phenylsulfanylaniline (PubChem CID 11066228) has the molecular formula C12H9N3O4S and a molecular weight of 291.29 g/mol. Its IUPAC name is 2,4-dinitro-6-phenylsulfanylaniline.
| Compound Name | 2,4-dinitro-6-phenylsulfanylaniline |
|---|---|
| PubChem CID | 11066228 |
| Molecular Formula | C12H9N3O4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2,4-dinitro-6-phenylsulfanylaniline |
| SMILES | Nc1c(Sc2ccccc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9N3O4S/c13-12-10(15(18)19)6-8(14(16)17)7-11(12)20-9-4-2-1-3-5-9/h1-7H,13H2 |
| InChIKey | KFQVDIHNJYFNSM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|