C24H14N4O9S2 — CID 3090660
1-[4-[4-(2,4-dinitrophenyl)sulfanylphenoxy]phenyl]sulfanyl-2,4-dinitrobenzene (PubChem CID 3090660) has the molecular formula C24H14N4O9S2 and a molecular weight of 566.53 g/mol. Its IUPAC name is 1-[4-[4-(2,4-dinitrophenyl)sulfanylphenoxy]phenyl]sulfanyl-2,4-dinitrobenzene.
| Compound Name | 1-[4-[4-(2,4-dinitrophenyl)sulfanylphenoxy]phenyl]sulfanyl-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 3090660 |
| Molecular Formula | C24H14N4O9S2 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.02 |
| IUPAC Name | 1-[4-[4-(2,4-dinitrophenyl)sulfanylphenoxy]phenyl]sulfanyl-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc(Oc3ccc(Sc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H14N4O9S2/c29-25(30)15-1-11-23(21(13-15)27(33)34)38-19-7-3-17(4-8-19)37-18-5-9-20(10-6-18)39-24-12-2-16(26(31)32)14-22(24)28(35)36/h1-14H |
| InChIKey | WDFNWRNGNDQMTO-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|