C6H6ClN3O4S — CID 175558039
S-(2,4-dinitrophenyl)thiohydroxylamine;hydrochloride (PubChem CID 175558039) has the molecular formula C6H6ClN3O4S and a molecular weight of 251.65 g/mol. Its IUPAC name is S-(2,4-dinitrophenyl)thiohydroxylamine;hydrochloride.
| Compound Name | S-(2,4-dinitrophenyl)thiohydroxylamine;hydrochloride |
|---|---|
| PubChem CID | 175558039 |
| Molecular Formula | C6H6ClN3O4S |
| Molecular Weight | 251.65 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | S-(2,4-dinitrophenyl)thiohydroxylamine;hydrochloride |
| SMILES | Cl.NSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5N3O4S.ClH/c7-14-6-2-1-4(8(10)11)3-5(6)9(12)13;/h1-3H,7H2;1H |
| InChIKey | VCBDAXZVVLUOLM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|