About amino-(2,4-dinitrophenyl)azanium;hydrochloride
amino-(2,4-dinitrophenyl)azanium;hydrochloride (PubChem CID 20513050) has the molecular formula C6H8ClN4O4+
and a molecular weight of 235.61 g/mol. Its IUPAC name is amino-(2,4-dinitrophenyl)azanium;hydrochloride.
Molecular Properties
| Compound Name | amino-(2,4-dinitrophenyl)azanium;hydrochloride |
| PubChem CID | 20513050 |
| Molecular Formula | C6H8ClN4O4+ |
| Molecular Weight | 235.61 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | amino-(2,4-dinitrophenyl)azanium;hydrochloride |
| SMILES | Cl.N[NH2+]c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N4O4.ClH/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;/h1-3,8H,7H2;1H/p+1 |
| InChIKey | PUYFAZQODQZOFK-UHFFFAOYSA-O |
| XLogP | -0.01 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.61 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino-(2,4-dinitrophenyl)azanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-(2,4-dinitrophenyl)azanium;hydrochloride?
The IUPAC name of amino-(2,4-dinitrophenyl)azanium;hydrochloride (CID 20513050) is amino-(2,4-dinitrophenyl)azanium;hydrochloride.
What is the SMILES notation for amino-(2,4-dinitrophenyl)azanium;hydrochloride?
The canonical SMILES for amino-(2,4-dinitrophenyl)azanium;hydrochloride is Cl.N[NH2+]c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of amino-(2,4-dinitrophenyl)azanium;hydrochloride?
The InChIKey is PUYFAZQODQZOFK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H6N4O4.ClH/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14;/h1-3,8H,7H2;1H/p+1.
What are the key properties of amino-(2,4-dinitrophenyl)azanium;hydrochloride?
amino-(2,4-dinitrophenyl)azanium;hydrochloride has a molecular weight of 235.61 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino-(2,4-dinitrophenyl)azanium;hydrochloride is sourced from PubChem (CID 20513050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).