C11H12N2O4S3 — CID 16638425
tert-butylsulfanyl-(2,4-dinitrophenyl)sulfanylmethanethione (PubChem CID 16638425) has the molecular formula C11H12N2O4S3 and a molecular weight of 332.43 g/mol. Its IUPAC name is tert-butylsulfanyl-(2,4-dinitrophenyl)sulfanylmethanethione.
| Compound Name | tert-butylsulfanyl-(2,4-dinitrophenyl)sulfanylmethanethione |
|---|---|
| PubChem CID | 16638425 |
| Molecular Formula | C11H12N2O4S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | tert-butylsulfanyl-(2,4-dinitrophenyl)sulfanylmethanethione |
| SMILES | CC(C)(C)SC(=S)Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O4S3/c1-11(2,3)20-10(18)19-9-5-4-7(12(14)15)6-8(9)13(16)17/h4-6H,1-3H3 |
| InChIKey | NYVICEBDDGSDRB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|