C11H11N3O4S2 — CID 9112818
(2,4-dinitrophenyl) pyrrolidine-1-carbodithioate (PubChem CID 9112818) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (2,4-dinitrophenyl) pyrrolidine-1-carbodithioate.
| Compound Name | (2,4-dinitrophenyl) pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 9112818 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (2,4-dinitrophenyl) pyrrolidine-1-carbodithioate |
| SMILES | O=[N+]([O-])c1ccc(SC(=S)N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N3O4S2/c15-13(16)8-3-4-10(9(7-8)14(17)18)20-11(19)12-5-1-2-6-12/h3-4,7H,1-2,5-6H2 |
| InChIKey | KKPMDHCVTFXQJJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|