C12H12N2O5S — CID 5248992
2-cyclobutylidene-2-(2,4-dinitrophenyl)sulfanylethanol (PubChem CID 5248992) has the molecular formula C12H12N2O5S and a molecular weight of 296.30 g/mol. Its IUPAC name is 2-cyclobutylidene-2-(2,4-dinitrophenyl)sulfanylethanol.
| Compound Name | 2-cyclobutylidene-2-(2,4-dinitrophenyl)sulfanylethanol |
|---|---|
| PubChem CID | 5248992 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-cyclobutylidene-2-(2,4-dinitrophenyl)sulfanylethanol |
| SMILES | O=[N+]([O-])c1ccc(SC(CO)=C2CCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N2O5S/c15-7-12(8-2-1-3-8)20-11-5-4-9(13(16)17)6-10(11)14(18)19/h4-6,15H,1-3,7H2 |
| InChIKey | LBCMPQBBMNHORQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|