C26H22N6O20S3 — CID 160925857
2-(2,4-dinitrophenyl)sulfanylacetic acid;[2-(2,4-dinitrophenyl)sulfanylacetyl]oxymethyl 2-(2,4-dinitrophenyl)sulfanylacetate;methanediol (PubChem CID 160925857) has the molecular formula C26H22N6O20S3 and a molecular weight of 834.68 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)sulfanylacetic acid;[2-(2,4-dinitrophenyl)sulfanylacetyl]oxymethyl 2-(2,4-dinitrophenyl)sulfanylacetate;methanediol.
| Compound Name | 2-(2,4-dinitrophenyl)sulfanylacetic acid;[2-(2,4-dinitrophenyl)sulfanylacetyl]oxymethyl 2-(2,4-dinitrophenyl)sulfanylacetate;methanediol |
|---|---|
| PubChem CID | 160925857 |
| Molecular Formula | C26H22N6O20S3 |
| Molecular Weight | 834.68 g/mol |
| Exact Mass | 834.01 |
| IUPAC Name | 2-(2,4-dinitrophenyl)sulfanylacetic acid;[2-(2,4-dinitrophenyl)sulfanylacetyl]oxymethyl 2-(2,4-dinitrophenyl)sulfanylacetate;methanediol |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])OCOC(=O)CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].O=C(O)CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].OCO |
| InChI | InChI=1S/C17H12N4O12S2.C8H6N2O6S.CH4O2/c22-16(7-34-14-3-1-10(18(24)25)5-12(14)20(28)29)32-9-33-17(23)8-35-15-4-2-11(19(26)27)6-13(15)21(30)31;11-8(12)4-17-7-2-1-5(9(13)14)3-6(7)10(15)16;2-1-3/h1-6H,7-9H2;1-3H,4H2,(H,11,12);2-3H,1H2 |
| InChIKey | SSPZZEYPTQOFJA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 389.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.68 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|