C10H12N2O6S2 — CID 43235168
2-[4-(dimethylsulfamoyl)-2-nitrophenyl]sulfanylacetic acid (PubChem CID 43235168) has the molecular formula C10H12N2O6S2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)-2-nitrophenyl]sulfanylacetic acid.
| Compound Name | 2-[4-(dimethylsulfamoyl)-2-nitrophenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 43235168 |
| Molecular Formula | C10H12N2O6S2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)-2-nitrophenyl]sulfanylacetic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(SCC(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H12N2O6S2/c1-11(2)20(17,18)7-3-4-9(19-6-10(13)14)8(5-7)12(15)16/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | GXQBMAKJYVIPEA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|