C8H10N4O5S2 — CID 5092729
4-(2-hydrazinyl-2-oxoethyl)sulfanyl-3-nitrobenzenesulfonamide (PubChem CID 5092729) has the molecular formula C8H10N4O5S2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-(2-hydrazinyl-2-oxoethyl)sulfanyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-(2-hydrazinyl-2-oxoethyl)sulfanyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5092729 |
| Molecular Formula | C8H10N4O5S2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 4-(2-hydrazinyl-2-oxoethyl)sulfanyl-3-nitrobenzenesulfonamide |
| SMILES | NNC(=O)CSc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N4O5S2/c9-11-8(13)4-18-7-2-1-5(19(10,16)17)3-6(7)12(14)15/h1-3H,4,9H2,(H,11,13)(H2,10,16,17) |
| InChIKey | DOFHDAIQWAPAFX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 158.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|