C20H23F3N2O5S2 — CID 4841846
N-(1-adamantylmethyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfanylacetamide (PubChem CID 4841846) has the molecular formula C20H23F3N2O5S2 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfanylacetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 4841846 |
| Molecular Formula | C20H23F3N2O5S2 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[2-nitro-4-(trifluoromethylsulfonyl)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-])NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H23F3N2O5S2/c21-20(22,23)32(29,30)15-1-2-17(16(6-15)25(27)28)31-10-18(26)24-11-19-7-12-3-13(8-19)5-14(4-12)9-19/h1-2,6,12-14H,3-5,7-11H2,(H,24,26) |
| InChIKey | CECQRFGVZPVJMH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|