C17H16F3N3O5S2 — CID 30474620
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 30474620) has the molecular formula C17H16F3N3O5S2 and a molecular weight of 463.46 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 30474620 |
| Molecular Formula | C17H16F3N3O5S2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16F3N3O5S2/c18-17(19,20)12-3-6-15(14(9-12)23(25)26)29-10-16(24)22-8-7-11-1-4-13(5-2-11)30(21,27)28/h1-6,9H,7-8,10H2,(H,22,24)(H2,21,27,28) |
| InChIKey | RDSJIFFEJWQFQV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|