C15H12F3N3O5S2 — CID 18161686
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(4-sulfamoylphenyl)acetamide (PubChem CID 18161686) has the molecular formula C15H12F3N3O5S2 and a molecular weight of 435.41 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 18161686 |
| Molecular Formula | C15H12F3N3O5S2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12F3N3O5S2/c16-15(17,18)9-1-6-13(12(7-9)21(23)24)27-8-14(22)20-10-2-4-11(5-3-10)28(19,25)26/h1-7H,8H2,(H,20,22)(H2,19,25,26) |
| InChIKey | HZLDHLXWUMYXSI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|