C18H14F3N3O4S — CID 55611783
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide (PubChem CID 55611783) has the molecular formula C18H14F3N3O4S and a molecular weight of 425.39 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 55611783 |
| Molecular Formula | C18H14F3N3O4S |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)acetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C18H14F3N3O4S/c19-18(20,21)11-2-5-15(14(8-11)24(27)28)29-9-17(26)22-12-3-4-13-10(7-12)1-6-16(25)23-13/h2-5,7-8H,1,6,9H2,(H,22,26)(H,23,25) |
| InChIKey | RTCIVUKZDHVVJR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|