C18H15F3N2O3S — CID 112759440
1-(3,4-dihydro-2H-quinolin-1-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone (PubChem CID 112759440) has the molecular formula C18H15F3N2O3S and a molecular weight of 396.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone |
|---|---|
| PubChem CID | 112759440 |
| Molecular Formula | C18H15F3N2O3S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H15F3N2O3S/c19-18(20,21)13-7-8-16(15(10-13)23(25)26)27-11-17(24)22-9-3-5-12-4-1-2-6-14(12)22/h1-2,4,6-8,10H,3,5,9,11H2 |
| InChIKey | WOGZDZFXAXLJPE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|