C19H16F3N3O5 — CID 4885391
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate (PubChem CID 4885391) has the molecular formula C19H16F3N3O5 and a molecular weight of 423.35 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 4885391 |
| Molecular Formula | C19H16F3N3O5 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)anilino]acetate |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H16F3N3O5/c20-19(21,22)13-5-6-14(16(9-13)25(28)29)23-10-18(27)30-11-17(26)24-8-7-12-3-1-2-4-15(12)24/h1-6,9,23H,7-8,10-11H2 |
| InChIKey | VNRKNMIBINNQBC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|