C23H22N4O8S — CID 5016410
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 5016410) has the molecular formula C23H22N4O8S and a molecular weight of 514.52 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 5016410 |
| Molecular Formula | C23H22N4O8S |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc(NCc2ccco2)c([N+](=O)[O-])c1)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C23H22N4O8S/c28-22(26-10-9-16-4-1-2-6-20(16)26)15-35-23(29)14-25-36(32,33)18-7-8-19(21(12-18)27(30)31)24-13-17-5-3-11-34-17/h1-8,11-12,24-25H,9-10,13-15H2 |
| InChIKey | CHLPZQGTBAACHT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 161.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|