C20H19FN4O6S — CID 4831855
N-[(4-fluorophenyl)methyl]-2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetamide (PubChem CID 4831855) has the molecular formula C20H19FN4O6S and a molecular weight of 462.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4831855 |
| Molecular Formula | C20H19FN4O6S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(NCc2ccco2)c([N+](=O)[O-])c1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H19FN4O6S/c21-15-5-3-14(4-6-15)11-23-20(26)13-24-32(29,30)17-7-8-18(19(10-17)25(27)28)22-12-16-2-1-9-31-16/h1-10,22,24H,11-13H2,(H,23,26) |
| InChIKey | UYHSALRKANBVMX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|