C21H20N4O8S — CID 16961726
(2-amino-2-oxo-1-phenylethyl) 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 16961726) has the molecular formula C21H20N4O8S and a molecular weight of 488.48 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 16961726 |
| Molecular Formula | C21H20N4O8S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | NC(=O)C(OC(=O)CNS(=O)(=O)c1ccc(NCc2ccco2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C21H20N4O8S/c22-21(27)20(14-5-2-1-3-6-14)33-19(26)13-24-34(30,31)16-8-9-17(18(11-16)25(28)29)23-12-15-7-4-10-32-15/h1-11,20,23-24H,12-13H2,(H2,22,27) |
| InChIKey | JVILMNPZOHYXCN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 183.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|