C18H19N5O9S — CID 42985385
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 42985385) has the molecular formula C18H19N5O9S and a molecular weight of 481.44 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 42985385 |
| Molecular Formula | C18H19N5O9S |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc(NCc2ccco2)c([N+](=O)[O-])c1)OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C18H19N5O9S/c24-16(22-6-5-19-18(22)26)11-32-17(25)10-21-33(29,30)13-3-4-14(15(8-13)23(27)28)20-9-12-2-1-7-31-12/h1-4,7-8,20-21H,5-6,9-11H2,(H,19,26) |
| InChIKey | XRPVYFBKDFVYCG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 190.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|