C13H12N3O7S- — CID 7063211
2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate (PubChem CID 7063211) has the molecular formula C13H12N3O7S- and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate.
| Compound Name | 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7063211 |
| Molecular Formula | C13H12N3O7S- |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-[[4-(furan-2-ylmethylamino)-3-nitrophenyl]sulfonylamino]acetate |
| SMILES | O=C([O-])CNS(=O)(=O)c1ccc(NCc2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N3O7S/c17-13(18)8-15-24(21,22)10-3-4-11(12(6-10)16(19)20)14-7-9-2-1-5-23-9/h1-6,14-15H,7-8H2,(H,17,18)/p-1 |
| InChIKey | WOKURNVOTCOPJS-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|