C17H23N3O5S2 — CID 9113582
N-tert-butyl-4-[2-(furan-2-ylmethylsulfanyl)ethylamino]-3-nitrobenzenesulfonamide (PubChem CID 9113582) has the molecular formula C17H23N3O5S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-tert-butyl-4-[2-(furan-2-ylmethylsulfanyl)ethylamino]-3-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-4-[2-(furan-2-ylmethylsulfanyl)ethylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9113582 |
| Molecular Formula | C17H23N3O5S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-tert-butyl-4-[2-(furan-2-ylmethylsulfanyl)ethylamino]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(NCCSCc2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H23N3O5S2/c1-17(2,3)19-27(23,24)14-6-7-15(16(11-14)20(21)22)18-8-10-26-12-13-5-4-9-25-13/h4-7,9,11,18-19H,8,10,12H2,1-3H3 |
| InChIKey | KTVKVHGYRSWKIR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|