C24H19N7O11S2 — CID 3098885
[[2,7-bis(furan-2-ylmethylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea (PubChem CID 3098885) has the molecular formula C24H19N7O11S2 and a molecular weight of 645.59 g/mol. Its IUPAC name is [[2,7-bis(furan-2-ylmethylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea.
| Compound Name | [[2,7-bis(furan-2-ylmethylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea |
|---|---|
| PubChem CID | 3098885 |
| Molecular Formula | C24H19N7O11S2 |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 645.06 |
| IUPAC Name | [[2,7-bis(furan-2-ylmethylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea |
| SMILES | NC(=O)NN=C1c2cc(S(=O)(=O)NCc3ccco3)cc([N+](=O)[O-])c2-c2c1cc(S(=O)(=O)NCc1ccco1)cc2[N+](=O)[O-] |
| InChI | InChI=1S/C24H19N7O11S2/c25-24(32)29-28-23-17-7-15(43(37,38)26-11-13-3-1-5-41-13)9-19(30(33)34)21(17)22-18(23)8-16(10-20(22)31(35)36)44(39,40)27-12-14-4-2-6-42-14/h1-10,26-27H,11-12H2,(H3,25,29,32) |
| InChIKey | WJWOVWUKNKVWSF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 272.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|