C22H27N7O9S2 — CID 71945467
[[2,7-bis(butylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea (PubChem CID 71945467) has the molecular formula C22H27N7O9S2 and a molecular weight of 597.63 g/mol. Its IUPAC name is [[2,7-bis(butylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea.
| Compound Name | [[2,7-bis(butylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea |
|---|---|
| PubChem CID | 71945467 |
| Molecular Formula | C22H27N7O9S2 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | [[2,7-bis(butylsulfamoyl)-4,5-dinitrofluoren-9-ylidene]amino]urea |
| SMILES | CCCCNS(=O)(=O)c1cc2c(c([N+](=O)[O-])c1)-c1c(cc(S(=O)(=O)NCCCC)cc1[N+](=O)[O-])C2=NNC(N)=O |
| InChI | InChI=1S/C22H27N7O9S2/c1-3-5-7-24-39(35,36)13-9-15-19(17(11-13)28(31)32)20-16(21(15)26-27-22(23)30)10-14(12-18(20)29(33)34)40(37,38)25-8-6-4-2/h9-12,24-25H,3-8H2,1-2H3,(H3,23,27,30) |
| InChIKey | DTXFEFOGEUEVMV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 246.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|