C18H13N5O10S2 — CID 172785548
1-(furan-2-ylmethyl)-9-hydroxyimino-4,5-dinitrofluorene-2,7-disulfonamide (PubChem CID 172785548) has the molecular formula C18H13N5O10S2 and a molecular weight of 523.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-9-hydroxyimino-4,5-dinitrofluorene-2,7-disulfonamide.
| Compound Name | 1-(furan-2-ylmethyl)-9-hydroxyimino-4,5-dinitrofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 172785548 |
| Molecular Formula | C18H13N5O10S2 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.01 |
| IUPAC Name | 1-(furan-2-ylmethyl)-9-hydroxyimino-4,5-dinitrofluorene-2,7-disulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(c([N+](=O)[O-])c1)-c1c([N+](=O)[O-])cc(S(N)(=O)=O)c(Cc3ccco3)c1C2=NO |
| InChI | InChI=1S/C18H13N5O10S2/c19-34(29,30)9-5-11-15(12(6-9)22(25)26)17-13(23(27)28)7-14(35(20,31)32)10(16(17)18(11)21-24)4-8-2-1-3-33-8/h1-3,5-7,24H,4H2,(H2,19,29,30)(H2,20,31,32) |
| InChIKey | OVNRKBMRTMPANU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 252.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|