C23H27N7O9S2 — CID 3102969
N-[2,7-bis[(4-methylpiperazin-1-yl)sulfonyl]-4,5-dinitrofluoren-9-ylidene]hydroxylamine (PubChem CID 3102969) has the molecular formula C23H27N7O9S2 and a molecular weight of 609.64 g/mol. Its IUPAC name is N-[2,7-bis[(4-methylpiperazin-1-yl)sulfonyl]-4,5-dinitrofluoren-9-ylidene]hydroxylamine.
| Compound Name | N-[2,7-bis[(4-methylpiperazin-1-yl)sulfonyl]-4,5-dinitrofluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 3102969 |
| Molecular Formula | C23H27N7O9S2 |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | N-[2,7-bis[(4-methylpiperazin-1-yl)sulfonyl]-4,5-dinitrofluoren-9-ylidene]hydroxylamine |
| SMILES | CN1CCN(S(=O)(=O)c2cc3c(c([N+](=O)[O-])c2)-c2c(cc(S(=O)(=O)N4CCN(C)CC4)cc2[N+](=O)[O-])C3=NO)CC1 |
| InChI | InChI=1S/C23H27N7O9S2/c1-25-3-7-27(8-4-25)40(36,37)15-11-17-21(19(13-15)29(32)33)22-18(23(17)24-31)12-16(14-20(22)30(34)35)41(38,39)28-9-5-26(2)6-10-28/h11-14,31H,3-10H2,1-2H3 |
| InChIKey | KAYXHZGIPIXKID-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 200.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|