C16H24N4O6S — CID 98794924
(3S,5S)-5-(hydroxymethyl)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-3-ol (PubChem CID 98794924) has the molecular formula C16H24N4O6S and a molecular weight of 400.46 g/mol. Its IUPAC name is (3S,5S)-5-(hydroxymethyl)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-3-ol.
| Compound Name | (3S,5S)-5-(hydroxymethyl)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 98794924 |
| Molecular Formula | C16H24N4O6S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (3S,5S)-5-(hydroxymethyl)-1-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pyrrolidin-3-ol |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N3C[C@@H](O)C[C@H]3CO)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H24N4O6S/c1-17-4-6-18(7-5-17)27(25,26)14-2-3-15(16(9-14)20(23)24)19-10-13(22)8-12(19)11-21/h2-3,9,12-13,21-22H,4-8,10-11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | AJBKUCIPRYHNBX-STQMWFEESA-N |
| XLogP | -0.54 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|