C22H27N5O5S2 — CID 58441879
(NE)-N-[2-(4-methylpiperazin-1-yl)sulfonyl-7-piperazin-1-ylsulfonylfluoren-9-ylidene]hydroxylamine (PubChem CID 58441879) has the molecular formula C22H27N5O5S2 and a molecular weight of 505.62 g/mol. Its IUPAC name is (NE)-N-[2-(4-methylpiperazin-1-yl)sulfonyl-7-piperazin-1-ylsulfonylfluoren-9-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(4-methylpiperazin-1-yl)sulfonyl-7-piperazin-1-ylsulfonylfluoren-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 58441879 |
| Molecular Formula | C22H27N5O5S2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | (NE)-N-[2-(4-methylpiperazin-1-yl)sulfonyl-7-piperazin-1-ylsulfonylfluoren-9-ylidene]hydroxylamine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc3c(c2)/C(=N/O)c2cc(S(=O)(=O)N4CCNCC4)ccc2-3)CC1 |
| InChI | InChI=1S/C22H27N5O5S2/c1-25-10-12-27(13-11-25)34(31,32)17-3-5-19-18-4-2-16(14-20(18)22(24-28)21(19)15-17)33(29,30)26-8-6-23-7-9-26/h2-5,14-15,23,28H,6-13H2,1H3/b24-22+ |
| InChIKey | BZJKXMUBJKYBLS-ZNTNEXAZSA-N |
| XLogP | 0.42 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|