C22H19N3O8S — CID 55317687
[2-(2-nitroanilino)-2-oxoethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 55317687) has the molecular formula C22H19N3O8S and a molecular weight of 485.47 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55317687 |
| Molecular Formula | C22H19N3O8S |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19N3O8S/c26-21(24-19-5-1-2-6-20(19)25(28)29)15-33-22(27)12-9-16-7-10-18(11-8-16)34(30,31)23-14-17-4-3-13-32-17/h1-13,23H,14-15H2,(H,24,26)/b12-9+ |
| InChIKey | LZBZLDKNGKIHRE-FMIVXFBMSA-N |
| XLogP | 2.86 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|