C21H20N2O6S2 — CID 29169479
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 29169479) has the molecular formula C21H20N2O6S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 29169479 |
| Molecular Formula | C21H20N2O6S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1)NCc1cccs1 |
| InChI | InChI=1S/C21H20N2O6S2/c24-20(22-14-18-4-2-12-30-18)15-29-21(25)10-7-16-5-8-19(9-6-16)31(26,27)23-13-17-3-1-11-28-17/h1-12,23H,13-15H2,(H,22,24)/b10-7+ |
| InChIKey | SVZNPQABVYUIIH-JXMROGBWSA-N |
| XLogP | 2.69 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|