C22H22N2O4S — CID 42992435
(E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 42992435) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 42992435 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (E)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O4S/c25-22(23-15-14-18-5-2-1-3-6-18)13-10-19-8-11-21(12-9-19)29(26,27)24-17-20-7-4-16-28-20/h1-13,16,24H,14-15,17H2,(H,23,25)/b13-10+ |
| InChIKey | TZLUDXVHVARNMW-JLHYYAGUSA-N |
| XLogP | 3.13 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|