C28H26N2O4S — CID 46546170
(E)-N-benzhydryl-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide (PubChem CID 46546170) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is (E)-N-benzhydryl-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-benzhydryl-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 46546170 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (E)-N-benzhydryl-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O4S/c1-30(28(23-9-4-2-5-10-23)24-11-6-3-7-12-24)27(31)19-16-22-14-17-26(18-15-22)35(32,33)29-21-25-13-8-20-34-25/h2-20,28-29H,21H2,1H3/b19-16+ |
| InChIKey | JKAAABXFLJVKIX-KNTRCKAVSA-N |
| XLogP | 5.02 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|