C24H23N3O4S2 — CID 40844535
(E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide (PubChem CID 40844535) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 40844535 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
| SMILES | C[C@H](c1nc2ccccc2s1)N(C)C(=O)/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-17(24-26-21-7-3-4-8-22(21)32-24)27(2)23(28)14-11-18-9-12-20(13-10-18)33(29,30)25-16-19-6-5-15-31-19/h3-15,17,25H,16H2,1-2H3/b14-11+/t17-/m1/s1 |
| InChIKey | FQQCURITUBDQMH-GWKQRERASA-N |
| XLogP | 4.60 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|