C20H19BrN2O4S2 — CID 55963723
N-[(4-bromothiophen-2-yl)methyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide (PubChem CID 55963723) has the molecular formula C20H19BrN2O4S2 and a molecular weight of 495.42 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55963723 |
| Molecular Formula | C20H19BrN2O4S2 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)C=Cc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H19BrN2O4S2/c1-23(13-18-11-16(21)14-28-18)20(24)9-6-15-4-7-19(8-5-15)29(25,26)22-12-17-3-2-10-27-17/h2-11,14,22H,12-13H2,1H3 |
| InChIKey | NGAXPQDYYKDHGL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|