C20H20N4O4S — CID 47786550
(E)-N,N-bis(2-cyanoethyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 47786550) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is (E)-N,N-bis(2-cyanoethyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N,N-bis(2-cyanoethyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 47786550 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (E)-N,N-bis(2-cyanoethyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | N#CCCN(CCC#N)C(=O)/C=C/c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c21-11-2-13-24(14-3-12-22)20(25)10-7-17-5-8-19(9-6-17)29(26,27)23-16-18-4-1-15-28-18/h1,4-10,15,23H,2-3,13-14,16H2/b10-7+ |
| InChIKey | DVRKWBGULNKGFD-JXMROGBWSA-N |
| XLogP | 2.43 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|