C19H17FN2OS — CID 8820349
(E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(4-fluorophenyl)-N-methylprop-2-enamide (PubChem CID 8820349) has the molecular formula C19H17FN2OS and a molecular weight of 340.42 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(4-fluorophenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(4-fluorophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 8820349 |
| Molecular Formula | C19H17FN2OS |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(4-fluorophenyl)-N-methylprop-2-enamide |
| SMILES | C[C@H](c1nc2ccccc2s1)N(C)C(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2OS/c1-13(19-21-16-5-3-4-6-17(16)24-19)22(2)18(23)12-9-14-7-10-15(20)11-8-14/h3-13H,1-2H3/b12-9+/t13-/m1/s1 |
| InChIKey | GWEBMZOMWUNQHZ-CNELAYHGSA-N |
| XLogP | 4.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|