C21H22N2O3S — CID 9406199
(E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 9406199) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9406199 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (E)-N-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(C)[C@H](C)c2nc3ccccc3s2)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O3S/c1-14(21-22-17-7-5-6-8-19(17)27-21)23(2)20(24)12-10-15-9-11-16(25-3)13-18(15)26-4/h5-14H,1-4H3/b12-10+/t14-/m1/s1 |
| InChIKey | MZGIWUOPQGCJRG-IEZBTEQYSA-N |
| XLogP | 4.55 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|