C22H22N2O3S — CID 8637269
[2-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate (PubChem CID 8637269) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is [2-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate.
| Compound Name | [2-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8637269 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccccc1/C=C/C(=O)OCC(=O)N(C)[C@H](C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H22N2O3S/c1-15-8-4-5-9-17(15)12-13-21(26)27-14-20(25)24(3)16(2)22-23-18-10-6-7-11-19(18)28-22/h4-13,16H,14H2,1-3H3/b13-12+/t16-/m1/s1 |
| InChIKey | ATZXVEKOQJPMQT-CJTWTEFWSA-N |
| XLogP | 4.38 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|