C22H19N3O3S — CID 8602157
[2-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(4-cyanophenyl)prop-2-enoate (PubChem CID 8602157) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is [2-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(4-cyanophenyl)prop-2-enoate.
| Compound Name | [2-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(4-cyanophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8602157 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | [2-[[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-methylamino]-2-oxoethyl] (E)-3-(4-cyanophenyl)prop-2-enoate |
| SMILES | C[C@@H](c1nc2ccccc2s1)N(C)C(=O)COC(=O)/C=C/c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-15(22-24-18-5-3-4-6-19(18)29-22)25(2)20(26)14-28-21(27)12-11-16-7-9-17(13-23)10-8-16/h3-12,15H,14H2,1-2H3/b12-11+/t15-/m0/s1 |
| InChIKey | IAWYXRWQNQPQER-RUMSDORHSA-N |
| XLogP | 3.94 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|