C19H16ClFN2OS — CID 9469368
(E)-N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2-chloro-6-fluorophenyl)-N-methylprop-2-enamide (PubChem CID 9469368) has the molecular formula C19H16ClFN2OS and a molecular weight of 374.87 g/mol. Its IUPAC name is (E)-N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2-chloro-6-fluorophenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2-chloro-6-fluorophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9469368 |
| Molecular Formula | C19H16ClFN2OS |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (E)-N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-3-(2-chloro-6-fluorophenyl)-N-methylprop-2-enamide |
| SMILES | C[C@@H](c1nc2ccccc2s1)N(C)C(=O)/C=C/c1c(F)cccc1Cl |
| InChI | InChI=1S/C19H16ClFN2OS/c1-12(19-22-16-8-3-4-9-17(16)25-19)23(2)18(24)11-10-13-14(20)6-5-7-15(13)21/h3-12H,1-2H3/b11-10+/t12-/m0/s1 |
| InChIKey | JCBVUWVLNQJZSG-IIANPFDCSA-N |
| XLogP | 5.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|