C22H26N2O5S2 — CID 3922626
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 3922626) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3922626 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(S(=O)(=O)N2CCCCCC2)cc1)NCc1cccs1 |
| InChI | InChI=1S/C22H26N2O5S2/c25-21(23-16-19-6-5-15-30-19)17-29-22(26)12-9-18-7-10-20(11-8-18)31(27,28)24-13-3-1-2-4-14-24/h5-12,15H,1-4,13-14,16-17H2,(H,23,25) |
| InChIKey | QUCUGBYNNNHWIV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|