C14H14FN3O5 — CID 75379407
2-(4-fluoro-5-methoxy-2-nitroanilino)-N-(furan-2-ylmethyl)acetamide (PubChem CID 75379407) has the molecular formula C14H14FN3O5 and a molecular weight of 323.28 g/mol. Its IUPAC name is 2-(4-fluoro-5-methoxy-2-nitroanilino)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-fluoro-5-methoxy-2-nitroanilino)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 75379407 |
| Molecular Formula | C14H14FN3O5 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-(4-fluoro-5-methoxy-2-nitroanilino)-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1cc(NCC(=O)NCc2ccco2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C14H14FN3O5/c1-22-13-6-11(12(18(20)21)5-10(13)15)16-8-14(19)17-7-9-3-2-4-23-9/h2-6,16H,7-8H2,1H3,(H,17,19) |
| InChIKey | FXOLSFDRAZVIPY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|