C11H16N2O5S2 — CID 115701984
4-(1-hydroxypropan-2-ylsulfanyl)-N,N-dimethyl-3-nitrobenzenesulfonamide (PubChem CID 115701984) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-(1-hydroxypropan-2-ylsulfanyl)-N,N-dimethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-(1-hydroxypropan-2-ylsulfanyl)-N,N-dimethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115701984 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-(1-hydroxypropan-2-ylsulfanyl)-N,N-dimethyl-3-nitrobenzenesulfonamide |
| SMILES | CC(CO)Sc1ccc(S(=O)(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O5S2/c1-8(7-14)19-11-5-4-9(6-10(11)13(15)16)20(17,18)12(2)3/h4-6,8,14H,7H2,1-3H3 |
| InChIKey | SGCDEBMZBAPVCG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|