C12H20N2O3S2 — CID 82901550
4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 82901550) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82901550 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(CCO)Sc1cc(S(=O)(=O)N(C)C)ccc1N |
| InChI | InChI=1S/C12H20N2O3S2/c1-9(6-7-15)18-12-8-10(4-5-11(12)13)19(16,17)14(2)3/h4-5,8-9,15H,6-7,13H2,1-3H3 |
| InChIKey | AXMVAEDPTNEBSX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|